3,3-bis(4-methoxyphenyl)-1-methylpyrrolidin-2-one structure
|
Common Name | 3,3-bis(4-methoxyphenyl)-1-methylpyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 123074-43-1 | Molecular Weight | 311.37500 | |
| Density | 1.148g/cm3 | Boiling Point | 475.6ºC at 760mmHg | |
| Molecular Formula | C19H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.4ºC | |
| Name | 3,3-bis(4-methoxyphenyl)-1-methylpyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 475.6ºC at 760mmHg |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.37500 |
| Flash Point | 241.4ºC |
| Exact Mass | 311.15200 |
| PSA | 38.77000 |
| LogP | 2.78990 |
| Vapour Pressure | 3.28E-09mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | HPGGQLNHVKZSOF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)CCN(C)C2=O)cc1 |
|
~2%
3,3-bis(4-metho... CAS#:123074-43-1 |
| Literature: Alonso, Ruben A.; Rodriguez, Carlos H.; Rossi, Roberto A. Journal of Organic Chemistry, 1989 , vol. 54, # 25 p. 5983 - 5985 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyrrolidin-2-one,3,3-bis(4-methoxyphenyl)-1-methyl |
| 1-methyl-3,3-(di-p-anisyl)-2-pyrrolidinone |