3,3-bis(4-methoxyphenyl)butan-2-one structure
|
Common Name | 3,3-bis(4-methoxyphenyl)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 22927-05-5 | Molecular Weight | 284.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-bis(4-methoxyphenyl)butan-2-one |
|---|
| Molecular Formula | C18H20O3 |
|---|---|
| Molecular Weight | 284.35000 |
| Exact Mass | 284.14100 |
| PSA | 35.53000 |
| LogP | 3.59880 |
| InChIKey | FPKVRENXFSRMAD-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)(C(C)=O)c2ccc(OC)cc2)cc1 |
|
~10%
3,3-bis(4-metho... CAS#:22927-05-5 |
| Literature: Rathore, Rajendra; Kochi, Jay K. Acta Chemica Scandinavica, 1998 , vol. 52, # 1 p. 114 - 130 |
|
~%
3,3-bis(4-metho... CAS#:22927-05-5 |
| Literature: Price; Mueller Journal of the American Chemical Society, 1944 , vol. 66, p. 634 |
|
~%
3,3-bis(4-metho... CAS#:22927-05-5 |
| Literature: So, Jeung-Ho; Park, Moon-Kyeu; Boudjouk, Philip Journal of Organic Chemistry, 1988 , vol. 53, # 25 p. 5871 - 5875 |
|
~%
3,3-bis(4-metho... CAS#:22927-05-5 |
| Literature: Sisido; Nozaki; Iwako Journal of the American Chemical Society, 1949 , vol. 71, p. 2037,2041 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |