1-BOC-4-METHYLPIPERIDINE structure
|
Common Name | 1-BOC-4-METHYLPIPERIDINE | ||
|---|---|---|---|---|
| CAS Number | 123387-50-8 | Molecular Weight | 199.29000 | |
| Density | 0.973g/cm3 | Boiling Point | 255ºC at 760mmHg | |
| Molecular Formula | C11H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108ºC | |
| Name | tert-butyl 4-methylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 255ºC at 760mmHg |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29000 |
| Flash Point | 108ºC |
| Exact Mass | 199.15700 |
| PSA | 29.54000 |
| LogP | 2.59130 |
| Vapour Pressure | 0.0167mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | OXSSNJRGXRJNPX-UHFFFAOYSA-N |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CC1 |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933399090 |
|
~99%
1-BOC-4-METHYLP... CAS#:123387-50-8 |
| Literature: Cossy, Janine; Belotti, Damien Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 15 p. 1989 - 1992 |
|
~86%
1-BOC-4-METHYLP... CAS#:123387-50-8 |
| Literature: Chandrasekhar; Babu, B. Nagendra; Reddy, Ch. Raji Tetrahedron Letters, 2003 , vol. 44, # 10 p. 2057 - 2059 |
|
~%
1-BOC-4-METHYLP... CAS#:123387-50-8 |
| Literature: EP2565192 A1, ; Paragraph 0533 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| t-butyl 4-methylpiperidine-1-carboxylate |
| n-boc-4-methylpiperidine |
| 1,1-dimethylethyl 4-methylpiperidine-1-carboxylate |
| 4-methyl-piperidin-1-carboxylic acid t-butyl ester |
| 1-Piperidinecarboxylicacid,4-methyl-,1,1-dimethylethyl ester |
| 4-Methylpiperidine-1-carboxylate tert-butyl |
| 1-Boc-4-Methylpiperidine |
| tert-butyl 4-methyl-1-piperidinecarboxylate |
| 4-methylpiperidine-1-carboxylic acid tert-butyl ester |