3-O-Caffeoylquinic acid methyl ester structure
|
Common Name | 3-O-Caffeoylquinic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 123483-19-2 | Molecular Weight | 368.335 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 577.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1±23.6 °C | |
Use of 3-O-Caffeoylquinic acid methyl ester3-O-Caffeoylquinic acid methyl ester is a chemical constituent of Pyrrosia calvata[1]. |
| Name | E6GC3KV7JK |
|---|---|
| Synonym | More Synonyms |
| Description | 3-O-Caffeoylquinic acid methyl ester is a chemical constituent of Pyrrosia calvata[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Chen YJ, et al. Chemical Constituents of Pyrrosia calvata. Nat Prod Commun. 2015 Jul;10(7):1191-3. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.0±50.0 °C at 760 mmHg |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.335 |
| Flash Point | 208.1±23.6 °C |
| Exact Mass | 368.110718 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | MZNIJRAPCCELQX-AWOKGZDASA-N |
| SMILES | COC(=O)C1(O)CC(O)C(O)C(OC(=O)C=Cc2ccc(O)c(O)c2)C1 |
| Methyl (1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]oxy}-1,4,5-trihydroxycyclohexanecarboxylate |
| Chlorogenic acid methyl ester, Methyl (1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]oxy}-1,4,5-trihydroxycyclohexanecarboxylate |
| Methyl (1S,3R,4R,5R)-3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4,5-trihydroxycyclohexanecarboxylate |
| E6GC3KV7JK |
| Methyl chlorogenate |
| Cyclohexanecarboxylic acid, 3-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-1,4,5-trihydroxy-, methyl ester, (1S,3R,4R,5R)- |