4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoic acid structure
|
Common Name | 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 123529-85-1 | Molecular Weight | 283.34300 | |
| Density | 1.246g/cm3 | Boiling Point | 563.8ºC at 760mmHg | |
| Molecular Formula | C13H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.8ºC | |
| Name | 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 563.8ºC at 760mmHg |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.34300 |
| Flash Point | 294.8ºC |
| Exact Mass | 283.08800 |
| PSA | 104.42000 |
| LogP | 2.22820 |
| Vapour Pressure | 1.51E-13mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | PRBWCDOXQVNOTE-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
4-methylsulfany... CAS#:123529-85-1 |
| Literature: Ronwin Journal of Organic Chemistry, 1953 , vol. 18, p. 1546,1549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(methylthio)-2-[(phenoxyacetyl)amino]butanoic acid |
| N-phenoxyacetyl-DL-methionine |
| L-Methionine,N-(phenoxyacetyl)-(9CI) |