4,4'-Bis(triethoxysilyl)-1,1'-biphenyl structure
|
Common Name | 4,4'-Bis(triethoxysilyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 123640-93-7 | Molecular Weight | 478.726 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 454.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C24H38O6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8±27.2 °C | |
| Name | 4,4'-Bis(triethoxysilyl)-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.9±38.0 °C at 760 mmHg |
| Molecular Formula | C24H38O6Si2 |
| Molecular Weight | 478.726 |
| Flash Point | 192.8±27.2 °C |
| Exact Mass | 478.220703 |
| PSA | 55.38000 |
| LogP | 5.52 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | KENDGHJJHKCUNB-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(-c2ccc([Si](OCC)(OCC)OCC)cc2)cc1 |
| WGK Germany | 3 |
|---|
|
~33%
4,4'-Bis(trieth... CAS#:123640-93-7 |
| Literature: Shea; Loy; Webster Journal of the American Chemical Society, 1992 , vol. 114, # 17 p. 6700 - 6710 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| triethoxy-[4-(4-triethoxysilylphenyl)phenyl]silane |
| 1,1'-Biphenyl, 4,4'-bis(triethoxysilyl)- |
| 4,4'-Bis(triethoxysilyl)biphenyl |
| 4,4'-Bis(triethoxysilyl)-1,1'-biphenyl |
| MFCD06798075 |
| 4,4′-bis-(triethoxysilyl)biphenyl |
| 4,4'-Biphenyldiylbis(triethoxysilane) |