4,4'-Bis(methoxymethyl)-1,1'-biphenyl structure
|
Common Name | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 3753-18-2 | Molecular Weight | 242.31300 | |
| Density | 1.039g/cm3 | Boiling Point | 350°C | |
| Molecular Formula | C16H18O2 | Melting Point | 49-50°C | |
| MSDS | N/A | Flash Point | 125.4ºC | |
| Name | 4,4'-Bis(methoxymethyl)-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 350°C |
| Melting Point | 49-50°C |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 125.4ºC |
| Exact Mass | 242.13100 |
| PSA | 18.46000 |
| LogP | 3.64640 |
| Index of Refraction | 1.542 |
| InChIKey | MODAACUAXYPNJH-UHFFFAOYSA-N |
| SMILES | COCc1ccc(-c2ccc(COC)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-Bis(methoxymethyl)biphenyl |
| MFCD03840532 |
| 1-(methoxymethyl)-4-[4-(methoxymethyl)phenyl]benzene |