N-(1-benzylpiperidin-4-yl)-N-phenylacetamide structure
|
Common Name | N-(1-benzylpiperidin-4-yl)-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 1237-52-1 | Molecular Weight | 308.41700 | |
| Density | 1.13g/cm3 | Boiling Point | 434.7ºC at 760mmHg | |
| Molecular Formula | C20H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | N-(1-benzylpiperidin-4-yl)-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760mmHg |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.41700 |
| Flash Point | 175.9ºC |
| Exact Mass | 308.18900 |
| PSA | 23.55000 |
| LogP | 3.64200 |
| Vapour Pressure | 9.28E-08mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | UKGXYSOSRSCGJB-UHFFFAOYSA-N |
| SMILES | CC(=O)N(c1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
N-(1-benzylpipe... CAS#:1237-52-1 |
| Literature: EP1559428 A1, ; Page/Page column 32 ; EP 1559428 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(1-benzyl-4-piperidinyl)-N-phenylacetamide |
| N-(1-benzyl-piperidin-4-yl)-N-phenyl-acetamide |
| Acetamide,N-phenyl-N-(1-benzyl-4-piperidinyl) |
| N-phenyl-N-[1-(phenylmethyl)-4-piperidinyl]acetamide |
| 1-Benzyl-4-(N-phenylacetamido)piperidine |
| Acetamide,N-phenyl-N-[1-(phenylmethyl)-4-piperidinyl] |
| EINECS 214-979-9 |