Di(p-tolyl)iodonium triflate structure
|
Common Name | Di(p-tolyl)iodonium triflate | ||
|---|---|---|---|---|
| CAS Number | 123726-16-9 | Molecular Weight | 458.2345396 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14F3IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Di(p-tolyl)iodonium triflate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14F3IO3S |
|---|---|
| Molecular Weight | 458.2345396 |
| InChIKey | CDEUHYARQIAHEG-UHFFFAOYSA-M |
| SMILES | Cc1ccc([I+]c2ccc(C)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Di(p-tolyl)iodonium triflate? |
| A: InChIKey of Di(p-tolyl)iodonium triflate is CDEUHYARQIAHEG-UHFFFAOYSA-M. |
| Q: What is the molecular weight of Di(p-tolyl)iodonium triflate? |
| A: Molecular weight of Di(p-tolyl)iodonium triflate is 458.2345396. |
| Q: What is the English name of Di(p-tolyl)iodonium triflate? |
| A: The English name of Di(p-tolyl)iodonium triflate is Di(p-tolyl)iodonium triflate. |
| Q: What is the CAS number of Di(p-tolyl)iodonium triflate? |
| A: CAS number of Di(p-tolyl)iodonium triflate is 123726-16-9. |
| Q: What is the safety information for Di(p-tolyl)iodonium triflate? |
| A: Safety information for Di(p-tolyl)iodonium triflate: 26. |
| Q: What is the SMILES notation of Di(p-tolyl)iodonium triflate? |
| A: SMILES notation of Di(p-tolyl)iodonium triflate is Cc1ccc([I+]c2ccc(C)cc2)cc1.O=S(=O)([O-])C(F)(F)F. |
| Q: What is the Chinese name of 123726-16-9? |
| A: Chinese name of 123726-16-9 is 123726-16-9. |
| Q: What is the molecular formula of Di(p-tolyl)iodonium triflate? |
| A: Molecular formula of Di(p-tolyl)iodonium triflate is C15H14F3IO3S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |