(S)-(+)-Glycidyl-4-nitrobenzoate structure
|
Common Name | (S)-(+)-Glycidyl-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 123750-60-7 | Molecular Weight | 259.236 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 440.3±20.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1±21.8 °C | |
| Name | Glycidyl (R)-(-)-4-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.3±20.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO6S |
| Molecular Weight | 259.236 |
| Flash Point | 220.1±21.8 °C |
| Exact Mass | 259.015045 |
| PSA | 110.10000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | CXYDYDCHYJXOEY-MRVPVSSYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCC2CO2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2910900090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzenesulfonic acid, 4-nitro-, (2R)-oxiranylmethyl ester |
| (2R)-2-Oxiranylmethyl 4-nitrobenzenesulfonate |
| (2R)-Oxiran-2-ylmethyl 4-nitrobenzenesulfonate |
| (S)-(+)-Glycidyl-4-nitrobenzoate |
| (R)-(-)-Glycidyl-4-nitrobenzenesulfonate |