(E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one
(E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one structure
|
Common Name | (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 123769-52-8 | Molecular Weight | 296.36000 | |
| Density | 1.094g/cm3 | Boiling Point | 453.3ºC at 760mmHg | |
| Molecular Formula | C19H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 453.3ºC at 760mmHg |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.36000 |
| Flash Point | 219.9ºC |
| Exact Mass | 296.14100 |
| PSA | 35.53000 |
| LogP | 4.38010 |
| Vapour Pressure | 2.09E-08mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | VGXDYWAJLBJIJX-ZRDIBKRKSA-N |
| SMILES | CCOc1ccc(C(=O)C=Cc2ccccc2)cc1OCC |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(3,4-Diethoxyphenyl)-3-phenyl-2-propen-1-one |
| 2-Propen-1-one,1-(3,4-diethoxyphenyl)-3-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: Polar surface area (PSA) of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is 35.53000. |
| Q: What is the SMILES notation of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: SMILES notation of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is CCOc1ccc(C(=O)C=Cc2ccccc2)cc1OCC. |
| Q: What is the CAS number of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: CAS number of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is 123769-52-8. |
| Q: What is the boiling point of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: Boiling point of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is 453.3ºC at 760mmHg. |
| Q: What English synonyms does (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one have? |
| A: English synonyms of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one: 1-(3,4-Diethoxyphenyl)-3-phenyl-2-propen-1-one, 2-Propen-1-one,1-(3,4-diethoxyphenyl)-3-phenyl. |
| Q: What is the InChIKey of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: InChIKey of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is VGXDYWAJLBJIJX-ZRDIBKRKSA-N. |
| Q: What is the LogP of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: LogP of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is 4.38010. |
| Q: What is the English name of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: The English name of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one. |
| Q: What are the upstream materials of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: Related upstream materials(CAS) of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one: 2050-46-6;102-92-1. |
| Q: What is the molecular weight of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one? |
| A: Molecular weight of (E)-1-(3,4-diethoxyphenyl)-3-phenylprop-2-en-1-one is 296.36000. |