2-(3-Piperidinyl)-1H-benzimidazole structure
|
Common Name | 2-(3-Piperidinyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 123771-23-3 | Molecular Weight | 201.26800 | |
| Density | 1.167g/cm3 | Boiling Point | 441.3ºC at 760mmHg | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.7ºC | |
| Name | 2-(Piperidin-3-yl)-1H-benzo[d]imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 441.3ºC at 760mmHg |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.26800 |
| Flash Point | 220.7ºC |
| Exact Mass | 201.12700 |
| PSA | 40.71000 |
| LogP | 2.35870 |
| Vapour Pressure | 5.48E-08mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | LQZIJJKVPOTLRE-UHFFFAOYSA-N |
| SMILES | c1ccc2[nH]c(C3CCCNC3)nc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~47%
2-(3-Piperidiny... CAS#:123771-23-3 |
| Literature: Wahlgren, Curtis G.; Addison, Anthony W. Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 541 - 543 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-piperidin-3-yl-1H-benzimidazole |