10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine
Modify Date: 2025-11-05 17:55:55
![10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine Structure](https://www.chemsrc.com/extcaspic/413/123792-63-2.png)
10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine structure
|
Common Name | 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 123792-63-2 | Molecular Weight | 240.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N2O2 |
|---|---|
| Molecular Weight | 240.26 |
| InChIKey | CXSQYSIOXSVWSE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc2c(c1)Cc1ccccc1CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: Molecular formula of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is C14H12N2O2. |
| Q: What is the InChIKey of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: InChIKey of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is CXSQYSIOXSVWSE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: CAS number of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is 123792-63-2. |
| Q: What is the English name of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: The English name of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine. |
| Q: What is the Chinese name of 123792-63-2? |
| A: Chinese name of 123792-63-2 is 123792-63-2. |
| Q: What is the SMILES notation of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: SMILES notation of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is O=[N+]([O-])c1cnc2c(c1)Cc1ccccc1CC2. |
| Q: What is the molecular weight of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine? |
| A: Molecular weight of 10,11-Dihydro-3-nitro-5H-benzo[4,5]cyclohepta[1,2-b]pyridine is 240.26. |