ethyl 3,4,5-trimethoxyphenacetylacetate
ethyl 3,4,5-trimethoxyphenacetylacetate structure
|
Common Name | ethyl 3,4,5-trimethoxyphenacetylacetate | ||
|---|---|---|---|---|
| CAS Number | 123794-62-7 | Molecular Weight | 296.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3,4,5-trimethoxyphenacetylacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O6 |
|---|---|
| Molecular Weight | 296.31600 |
| Exact Mass | 296.12600 |
| PSA | 71.06000 |
| LogP | 1.77720 |
| InChIKey | QPGNMQVDKLQLIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine structure](https://image.chemsrc.com/caspic/183/123794-64-9.png)
CAS#:123794-64-9![6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine structure](https://image.chemsrc.com/caspic/186/61550-88-7.png)
CAS#:61550-88-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: Polar surface area (PSA) of ethyl 3,4,5-trimethoxyphenacetylacetate is 71.06000. |
| Q: What is the CAS number of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: CAS number of ethyl 3,4,5-trimethoxyphenacetylacetate is 123794-62-7. |
| Q: What is the molecular formula of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: Molecular formula of ethyl 3,4,5-trimethoxyphenacetylacetate is C15H20O6. |
| Q: What is the LogP of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: LogP of ethyl 3,4,5-trimethoxyphenacetylacetate is 1.77720. |
| Q: What is the English name of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: The English name of ethyl 3,4,5-trimethoxyphenacetylacetate is ethyl 3,4,5-trimethoxyphenacetylacetate. |
| Q: What is the molecular weight of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: Molecular weight of ethyl 3,4,5-trimethoxyphenacetylacetate is 296.31600. |
| Q: What is the SMILES notation of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: SMILES notation of ethyl 3,4,5-trimethoxyphenacetylacetate is CCOC(=O)CC(=O)Cc1cc(OC)c(OC)c(OC)c1. |
| Q: What is the InChIKey of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: InChIKey of ethyl 3,4,5-trimethoxyphenacetylacetate is QPGNMQVDKLQLIJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 123794-62-7? |
| A: Chinese name of 123794-62-7 is 123794-62-7. |
| Q: What are the downstream products of ethyl 3,4,5-trimethoxyphenacetylacetate? |
| A: Related downstream products(CAS) of ethyl 3,4,5-trimethoxyphenacetylacetate: 123794-64-9;61550-88-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |