4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine
![4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine Structure](https://image.chemsrc.com/caspic/183/123794-64-9.png)
4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine structure
|
Common Name | 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 123794-64-9 | Molecular Weight | 324.75900 | |
| Density | 1.233g/cm3 | Boiling Point | 452.6ºC at 760 mmHg | |
| Molecular Formula | C15H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 452.6ºC at 760 mmHg |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.75900 |
| Flash Point | 227.5ºC |
| Exact Mass | 324.08800 |
| PSA | 62.70000 |
| LogP | 2.75520 |
| Vapour Pressure | 5.93E-08mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | DRAURIOHXMXMFM-UHFFFAOYSA-N |
| SMILES | COc1nc(Cl)cc(Cc2cc(OC)c(OC)c(OC)c2)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-chloro-2-meth... CAS#:123794-64-9 |
| Literature: Botta; Artico; Massa; Gambacorta Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 883 - 884 |
|
~%
4-chloro-2-meth... CAS#:123794-64-9 |
| Literature: Botta; Artico; Massa; Gambacorta Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 883 - 884 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
![2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine structure](https://image.chemsrc.com/caspic/259/143467-57-6.png)
CAS#:143467-57-6![6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine structure](https://image.chemsrc.com/caspic/186/61550-88-7.png)
CAS#:61550-88-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyrimidine,4-chloro-2-methoxy-6-((3,4,5-trimethoxyphenyl)methyl) |
| 4-Chloro-2-methoxy-6-(3,4,5-trimethoxy-benzyl)-pyrimidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: SMILES notation of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is COc1nc(Cl)cc(Cc2cc(OC)c(OC)c(OC)c2)n1. |
| Q: What are the upstream materials of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: Related upstream materials(CAS) of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine: 39053-78-6;123794-62-7. |
| Q: What English synonyms does 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine have? |
| A: English synonyms of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine: Pyrimidine,4-chloro-2-methoxy-6-((3,4,5-trimethoxyphenyl)methyl), 4-Chloro-2-methoxy-6-(3,4,5-trimethoxy-benzyl)-pyrimidine. |
| Q: What is the boiling point of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: Boiling point of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is 452.6ºC at 760 mmHg. |
| Q: What is the CAS number of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: CAS number of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is 123794-64-9. |
| Q: What is the molecular weight of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: Molecular weight of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is 324.75900. |
| Q: What is the InChIKey of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: InChIKey of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is DRAURIOHXMXMFM-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: LogP of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is 2.75520. |
| Q: What is the English name of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine? |
| A: The English name of 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine is 4-chloro-2-methoxy-6-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine. |
| Q: What is the Chinese name of 123794-64-9? |
| A: Chinese name of 123794-64-9 is 123794-64-9. |