triptotriterpenic acid C structure
|
Common Name | triptotriterpenic acid C | ||
|---|---|---|---|---|
| CAS Number | 123914-32-9 | Molecular Weight | 472.70000 | |
| Density | 1.14g/cm3 | Boiling Point | 587.5ºC at 760mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.2ºC | |
Use of triptotriterpenic acid CTriptotriterpenic acid C is a ursolic-type acid that can be isolated from total glycosides extracted from the root of Tripterygium wilfordii Hook.f.[1]. |
| Name | (3β,5ξ,18α,22α)-3,22-Dihydroxyurs-12-en-30-oic acid |
|---|
| Description | Triptotriterpenic acid C is a ursolic-type acid that can be isolated from total glycosides extracted from the root of Tripterygium wilfordii Hook.f.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 587.5ºC at 760mmHg |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.70000 |
| Flash Point | 323.2ºC |
| Exact Mass | 472.35500 |
| PSA | 77.76000 |
| LogP | 6.06030 |
| Vapour Pressure | 2.99E-16mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | IWVWTVWLRSUYNC-ULUYBTNLSA-N |
| SMILES | CC1C(C(=O)O)CC(O)C2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |