Triptotriterpenic acid A structure
|
Common Name | Triptotriterpenic acid A | ||
|---|---|---|---|---|
| CAS Number | 84108-17-8 | Molecular Weight | 472.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 586.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4±26.6 °C | |
Use of Triptotriterpenic acid ATriptotriterpenic acid A is a natural product from Tripterygium wilfordii[1]. |
| Name | (3β,22α)-3,22-Dihydroxyolean-12-en-29-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Triptotriterpenic acid A is a natural product from Tripterygium wilfordii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 586.2±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.700 |
| Flash Point | 322.4±26.6 °C |
| Exact Mass | 472.355255 |
| PSA | 77.76000 |
| LogP | 7.40 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | JTBGJQZJEYVBJZ-YLXTXNMFSA-N |
| SMILES | CC1(C(=O)O)CC(O)C2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1 |
| Hazard Codes | Xi |
|---|
|
~%
Triptotriterpen... CAS#:84108-17-8 |
| Literature: Chang, Hson-Mou; Chiang, Teh-Chang; Mak, Thomas C. W. Journal of the Chemical Society, Chemical Communications, 1982 , # 20 p. 1197 - 1198 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Olean-12-en-28-oic acid, 3,15-dihydroxy-, (3β,15β)- |
| (3β,15β)-3,15-Dihydroxyolean-12-en-28-oic acid |
| maytenfolic acid |
| Triptotriterpenic acid A |
| Olean-12-en-29-oic acid, 3,22-dihydroxy-, (3β,22α)- |
| (3β,22α)-3,22-Dihydroxyolean-12-en-29-oic acid |