NP-1815-PX sodium structure
|
Common Name | NP-1815-PX sodium | ||
|---|---|---|---|---|
| CAS Number | 1239578-80-3 | Molecular Weight | 424.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H13N4NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NP-1815-PX sodiumNP-1815-PX sodium is a potent and selective P2X4R antagonist. NP-1815-PX sodium has anti-inflammatory activity, and can relieve pain in chronic pain models. NP-1815-PX sodium also inhibits guinea pig tracheal/bronchial smooth muscle (TSM and BSM) contractions[1][2][3]. |
| Name | NP-1815-PX sodium |
|---|
| Description | NP-1815-PX sodium is a potent and selective P2X4R antagonist. NP-1815-PX sodium has anti-inflammatory activity, and can relieve pain in chronic pain models. NP-1815-PX sodium also inhibits guinea pig tracheal/bronchial smooth muscle (TSM and BSM) contractions[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H13N4NaO3S |
|---|---|
| Molecular Weight | 424.41 |
| InChIKey | MIBCQKIVVIBTLQ-UHFFFAOYSA-M |
| SMILES | O=C1CC(=O)N(c2cccc(-c3nc(=S)o[nH]3)c2)c2ccc3ccccc3c2[N-]1.[Na+] |