ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate
Modify Date: 2026-07-06 12:11:30
ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate structure
|
Common Name | ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1239844-77-9 | Molecular Weight | 249.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H9BrN2O3 |
|---|---|
| Molecular Weight | 249.06 |
| InChIKey | SJPXQCKYTRMYSF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]n(C)c(=O)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: CAS number of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is 1239844-77-9. |
| Q: What is the English name of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: The English name of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate. |
| Q: What is the molecular formula of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular formula of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is C7H9BrN2O3. |
| Q: What is the SMILES notation of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: SMILES notation of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is CCOC(=O)c1[nH]n(C)c(=O)c1Br. |
| Q: What is the InChIKey of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: InChIKey of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is SJPXQCKYTRMYSF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate? |
| A: Molecular weight of ethyl 4-bromo-5-hydroxy-1-methyl-1H-pyrazole-3-carboxylate is 249.06. |
| Q: What is the Chinese name of 1239844-77-9? |
| A: Chinese name of 1239844-77-9 is 1239844-77-9. |