2-(4-bromoanilino)-3,7-dihydropurin-6-one structure
|
Common Name | 2-(4-bromoanilino)-3,7-dihydropurin-6-one | ||
|---|---|---|---|---|
| CAS Number | 123994-72-9 | Molecular Weight | 306.11800 | |
| Density | 1.94g/cm3 | Boiling Point | 572.5ºC at 760mmHg | |
| Molecular Formula | C11H8BrN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1ºC | |
| Name | 2-(4-bromoanilino)-3,7-dihydropurin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 572.5ºC at 760mmHg |
| Molecular Formula | C11H8BrN5O |
| Molecular Weight | 306.11800 |
| Flash Point | 300.1ºC |
| Exact Mass | 304.99100 |
| PSA | 86.72000 |
| LogP | 2.63760 |
| Vapour Pressure | 4.07E-13mmHg at 25°C |
| Index of Refraction | 1.831 |
| InChIKey | LAAOZGLNGLIEGP-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(Nc2ccc(Br)cc2)nc2nc[nH]c12 |
|
~61%
2-(4-bromoanili... CAS#:123994-72-9 |
| Literature: Noonan, Timothy; Brown, Neal; Dudycz, Lech; Wright, George Journal of Medicinal Chemistry, 1991 , vol. 34, # 4 p. 1302 - 1307 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N2-(p-bromophenyl)guanine |
| 6H-Purin-6-one,2-[(4-bromophenyl)amino]-1,9-dihydro |