2-(4-methylanilino)-3,7-dihydropurin-6-one
Modify Date: 2025-09-30 16:33:57
2-(4-methylanilino)-3,7-dihydropurin-6-one structure
|
Common Name | 2-(4-methylanilino)-3,7-dihydropurin-6-one | ||
|---|---|---|---|---|
| CAS Number | 57338-66-6 | Molecular Weight | 241.24900 | |
| Density | 1.5g/cm3 | Boiling Point | 536.5ºC at 760 mmHg | |
| Molecular Formula | C12H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.3ºC | |
| Name | 2-(4-methylanilino)-3,7-dihydropurin-6-one |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 536.5ºC at 760 mmHg |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.24900 |
| Flash Point | 278.3ºC |
| Exact Mass | 241.09600 |
| PSA | 86.72000 |
| LogP | 2.18350 |
| Index of Refraction | 1.763 |
| InChIKey | HFXAMEWMAYIKHR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2nc3nc[nH]c3c(=O)[nH]2)cc1 |
| HS Code | 2933990090 |
|---|
|
~69%
2-(4-methylanil... CAS#:57338-66-6 |
| Literature: Focher; Hildebrand; Freese; Ciarrocchi; Noonan; Sangalli; Brown; Spadari; Wright Journal of medicinal chemistry, 1988 , vol. 31, # 8 p. 1496 - 1500 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |