N,N'-Bis(5-hydroxysalicylidene)ethylenediamine structure
|
Common Name | N,N'-Bis(5-hydroxysalicylidene)ethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 124061-43-4 | Molecular Weight | 300.30900 | |
| Density | 1.559g/cm3 | Boiling Point | 481.8ºC at 760mmHg | |
| Molecular Formula | C16H16N2O4 | Melting Point | 125-127ºC | |
| MSDS | N/A | Flash Point | 245.2ºC | |
| Name | n,n-bis(2,5-dihydroxybenzylidene)ethylenediamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 481.8ºC at 760mmHg |
| Melting Point | 125-127ºC |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Flash Point | 245.2ºC |
| Exact Mass | 300.11100 |
| PSA | 105.64000 |
| LogP | 2.04700 |
| Vapour Pressure | 2.63E-11mmHg at 25°C |
| Index of Refraction | 1.823 |
| InChIKey | KQVXRKRRCLZZKX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(O)c(C=NCCN=Cc2cc(O)ccc2O)c1 |
|
~99%
N,N'-Bis(5-hydr... CAS#:124061-43-4 |
| Literature: Lamour, Eric; Routier, Sylvain; Bernier, Jean-Luc; Catteau, Jean-Pierre; Bailly, Christian; Vezin, Herve Journal of the American Chemical Society, 1999 , vol. 121, # 9 p. 1862 - 1869 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N'-Ethylenebis(5-hydroxysalicylideneimine) |
| N,N'-Bis(5-hydroxysalicylidene)ethylenediaMine |
| N,N-Bis(2,5-dihydroxybenzylidene)ethylenediamine |
| 5,5'-dihydroxysalen |
| 5,5'-DIHYDROXYSALICYLALDEHYDETHYLENEDIIMINE |