[4-(4-methoxyphenyl)piperazin-1-yl]-pyridin-3-ylmethanone structure
|
Common Name | [4-(4-methoxyphenyl)piperazin-1-yl]-pyridin-3-ylmethanone | ||
|---|---|---|---|---|
| CAS Number | 124444-87-7 | Molecular Weight | 297.35200 | |
| Density | 1.203g/cm3 | Boiling Point | 512ºC at 760mmHg | |
| Molecular Formula | C17H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.4ºC | |
| Name | [4-(4-methoxyphenyl)piperazin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 512ºC at 760mmHg |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.35200 |
| Flash Point | 263.4ºC |
| Exact Mass | 297.14800 |
| PSA | 45.67000 |
| LogP | 2.05550 |
| Vapour Pressure | 1.35E-10mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | PCOKOSRFMZFUCH-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(C(=O)c3cccnc3)CC2)cc1 |
|
~84%
[4-(4-methoxyph... CAS#:124444-87-7 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 59, # 10 p. 2343 - 2350 |
|
~%
[4-(4-methoxyph... CAS#:124444-87-7 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 59, # 10 p. 2343 - 2350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Piperazine,1-(4-methoxyphenyl)-4-(3-pyridinylcarbonyl) |
| B-1 280 |
| 1-(4-methoxyphenyl)-4-nicotinoylpiperazine |
| 1-(4-Methoxyphenyl)-4-(3-pyridinylcarbonyl)piperazine |