4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1245645-97-9 | Molecular Weight | 197.579 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Exact Mass | 196.999207 |
| PSA | 74.50000 |
| LogP | 2.85 |
| Index of Refraction | 1.742 |
| InChIKey | WOFUUJSVPQZPIH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc2[nH]ccc2c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-5-nitro-1H-pyrrolo[2,3-b]pyridine |
| 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-nitro- |