N-ACETOXY-N-ETHOXYBENZAMIDE structure
|
Common Name | N-ACETOXY-N-ETHOXYBENZAMIDE | ||
|---|---|---|---|---|
| CAS Number | 124617-83-0 | Molecular Weight | 223.22500 | |
| Density | 1.19g/cm3 | Boiling Point | 290.7ºC at 760mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.6ºC | |
| Name | [benzoyl(ethoxy)amino] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 290.7ºC at 760mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 129.6ºC |
| Exact Mass | 223.08400 |
| PSA | 55.84000 |
| LogP | 1.55840 |
| Vapour Pressure | 0.00204mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | VTXASKVCTCLBRE-UHFFFAOYSA-N |
| SMILES | CCON(OC(C)=O)C(=O)c1ccccc1 |
|
~92%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Russian Chemical Bulletin, , vol. 52, # 10 p. 2251 - 2260 |
|
~97%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Tetrahedron Letters, , vol. 30, # 20 p. 2649 - 2652 |
|
~%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , # 12 p. 2067 - 2080 |
|
~%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , # 12 p. 2067 - 2080 |
|
~%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , # 12 p. 2067 - 2080 |
|
~%
N-ACETOXY-N-ETH... CAS#:124617-83-0 |
| Literature: Mendeleev Communications, , vol. 14, # 5 p. 208 - 210 |
| VTXASKVCTCLBRE-UHFFFAOYSA |
| Acetic acid,benzoylethoxyazanyl ester |
| N-(acetyloxy)-N-ethoxybenzamide |
| N-Acetoxy-N-ethoxybenzamide |
| ethyl N-acetoxybenzohydroxamate |
| (benzoyl-ethoxyamino) acetate |