Praziquantel D11 structure
|
Common Name | Praziquantel D11 | ||
|---|---|---|---|---|
| CAS Number | 1246343-36-1 | Molecular Weight | 323.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13D11N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Praziquantel D11Praziquantel D11 is the deuterium labeled Praziquantel, which is an anthelmintic. |
| Name | 2-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Praziquantel D11 is the deuterium labeled Praziquantel, which is an anthelmintic. |
|---|---|
| Related Catalog |
| Molecular Formula | C19H13D11N2O2 |
|---|---|
| Molecular Weight | 323.47400 |
| Exact Mass | 323.25300 |
| PSA | 40.62000 |
| LogP | 2.41070 |
| InChIKey | FSVJFNAIGNNGKK-DHCOBZMXSA-N |
| SMILES | O=C(C1CCCCC1)N1CC(=O)N2CCc3ccccc3C2C1 |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|
| 2-(Cyclohexyl-d11-carbonyl)-1,2,3,6,7-11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one |
| Droncit-d11 |
| Azinox-d11 |
| Cesol-d11 |
| Biltricide-d11 |
| Praziquantel-d11 |
| Prazinon-d11 |
| Warmnil-d11 |
| Distocide-d11 |
| Cysticide-d11 |
| Pyquiton-d11 |
| Praziquantel D11 |