5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione
Modify Date: 2026-08-02 13:41:50
![5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione Structure](https://www.chemsrc.com/extcaspic/171/1246617-48-0.png)
5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione structure
|
Common Name | 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 1246617-48-0 | Molecular Weight | 313.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19N3O3 |
|---|---|
| Molecular Weight | 313.35 |
| InChIKey | JBDBZIPTJKMMSQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1CNn2ccc(=O)c(OCc3ccccc3)c2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: Molecular weight of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is 313.35. |
| Q: What is the CAS number of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: CAS number of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is 1246617-48-0. |
| Q: What is the SMILES notation of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: SMILES notation of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is CC(C)N1CNn2ccc(=O)c(OCc3ccccc3)c2C1=O. |
| Q: What is the molecular formula of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: Molecular formula of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is C17H19N3O3. |
| Q: What is the Chinese name of 1246617-48-0? |
| A: Chinese name of 1246617-48-0 is 1246617-48-0. |
| Q: What is the English name of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: The English name of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione. |
| Q: What is the InChIKey of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione? |
| A: InChIKey of 5-(benzyloxy)-3-isopropyl-2,3-dihydro-1H-pyrido[2,1-f][1,2,4]triazine-4,6-dione is JBDBZIPTJKMMSQ-UHFFFAOYSA-N. |