Bis(pentafluorophenyl)divinylstannane structure
|
Common Name | Bis(pentafluorophenyl)divinylstannane | ||
|---|---|---|---|---|
| CAS Number | 1247-12-7 | Molecular Weight | 506.90400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H6F10Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(ethenyl)-bis(2,3,4,5,6-pentafluorophenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H6F10Sn |
|---|---|
| Molecular Weight | 506.90400 |
| Exact Mass | 507.93300 |
| LogP | 6.32040 |
| InChIKey | AJICOJCRYZXBEL-UHFFFAOYSA-N |
| SMILES | C=C[Sn](C=C)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2931900090 |
|---|
|
~77%
Bis(pentafluoro... CAS#:1247-12-7 |
| Literature: Gmelin Handbook: F: PerFHalOrg.4, 2.2.4, page 68 - 115 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tin,bis(pentafluorophenyl)divinyl |
| Bis(pentafluorophenyl)divinylstannane |
| Stannane,bis(pentafluorophenyl)divinyl |