pentafluorophenylmagnesium bromide structure
|
Common Name | pentafluorophenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 879-05-0 | Molecular Weight | 271.26500 | |
| Density | 0.861 g/mL at 25ºC | Boiling Point | 34.6ºC | |
| Molecular Formula | C6BrF5Mg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -35 °F | |
| Name | magnesium,1,2,3,4,5-pentafluorobenzene-6-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.861 g/mL at 25ºC |
|---|---|
| Boiling Point | 34.6ºC |
| Molecular Formula | C6BrF5Mg |
| Molecular Weight | 271.26500 |
| Flash Point | -35 °F |
| Exact Mass | 269.89500 |
| InChIKey | AMQDBUIQKQUCKY-UHFFFAOYSA-M |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[Br-].[Mg+2] |
| Hazard Codes | F+: Highly flammable;C: Corrosive; |
|---|---|
| Risk Phrases | 12-14-19-22-34-66-67 |
| Safety Phrases | 26-36/37/39-43-45 |
| RIDADR | UN 2924 3/PG 1 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Pentafluorophenylmagnesium bromide solution |
| pentafluorophenylmagnesium bromide |
| per-fluorophenyl magnesium bromide |
| 2,3,4,5,6-pentafluorophenylmagnesium bromide |
| Magnesium,bromo(pentafluorophenyl) |
| MFCD00015720 |