Androst-16-ene-3,17-diol,diacetate, (3b,5a)- (9CI) structure
|
Common Name | Androst-16-ene-3,17-diol,diacetate, (3b,5a)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1247-67-2 | Molecular Weight | 374.51400 | |
| Density | 1.12g/cm3 | Boiling Point | 463ºC at 760mmHg | |
| Molecular Formula | C23H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | [(8R,9S,10S,13S,14S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 463ºC at 760mmHg |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.51400 |
| Flash Point | 223.8ºC |
| Exact Mass | 374.24600 |
| PSA | 52.60000 |
| LogP | 5.01770 |
| Vapour Pressure | 9.43E-09mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | GDNCPMQDMBBSRP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CCC2C3CCC4CC(OC(C)=O)CCC4(C)C3CCC12C |
|
~%
Androst-16-ene-... CAS#:1247-67-2 |
| Literature: Pappo et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 6347,6352 |
|
~67%
Androst-16-ene-... CAS#:1247-67-2 |
| Literature: Sherwin; McMullan; Covey Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 651 - 658 |
|
~%
Androst-16-ene-... CAS#:1247-67-2 |
| Literature: Mazur,Y. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 5889 - 5908 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Andersen's sulfinate |
| menthyl p-toluenesulfinate |
| andrographidine |
| andrographidine C |