2-Propyl-1H-Imidazole-4,5-Dicarboxylic Acid Dimethyl Ester structure
|
Common Name | 2-Propyl-1H-Imidazole-4,5-Dicarboxylic Acid Dimethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 124750-59-0 | Molecular Weight | 226.22900 | |
| Density | 1.215g/cm3 | Boiling Point | 377.8ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 2-Propyl-1H-Imidazole-4,5-Dicarboxylic Acid Dimethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 377.8ºC at 760 mmHg |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.22900 |
| Flash Point | 182.3ºC |
| Exact Mass | 226.09500 |
| PSA | 81.28000 |
| LogP | 0.93540 |
| Vapour Pressure | 6.58E-06mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | FGBHVVBYDOTMMD-UHFFFAOYSA-N |
| SMILES | CCCc1nc(C(=O)OC)c(C(=O)OC)[nH]1 |
| HS Code | 2933290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Propyl-1H-imidazole-4,5-dicarboxylic acid dimethyl ester |
| Dimethyl 2-propyl-1H-imidazole-4,5-dicarboxylate |