4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one
4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one structure
|
Common Name | 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 124946-65-2 | Molecular Weight | 192.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12O3 |
|---|---|
| Molecular Weight | 192.21100 |
| Exact Mass | 192.07900 |
| PSA | 46.53000 |
| LogP | 2.00300 |
| InChIKey | WBNXNIPUDZZFBV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=CC(C)=O)c(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~39%
4-(2-hydroxy-4-... CAS#:124946-65-2 |
| Literature: Tatsuzaki, Jin; Bastow, Kenneth F.; Nakagawa-Goto, Kyoko; Nakamura, Seiko; Itokawa, Hideji; Lee, Kuo-Hsiung Journal of Natural Products, 2006 , vol. 69, # 10 p. 1445 - 1449 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(2-Hydroxy-4-methoxy-phenyl)-but-3-en-2-on |
| 4-(2-hydroxy-4-methoxy-phenyl)-but-3-en-2-one |
| 1t-(2-hydroxy-4-methoxy-phenyl)-buten-(1)-one-(3) |
| 1t-(2-Hydroxy-4-methoxy-phenyl)-buten-(1)-on-(3) |
| 3-Buten-2-one,4-(2-hydroxy-4-methoxyphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: Related upstream materials(CAS) of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one: 673-22-3;67-64-1. |
| Q: What English synonyms does 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one have? |
| A: English synonyms of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one: 4-(2-Hydroxy-4-methoxy-phenyl)-but-3-en-2-on, 4-(2-hydroxy-4-methoxy-phenyl)-but-3-en-2-one, 1t-(2-hydroxy-4-methoxy-phenyl)-buten-(1)-one-(3), 1t-(2-Hydroxy-4-methoxy-phenyl)-buten-(1)-on-(3), 3-Buten-2-one,4-(2-hydroxy-4-methoxyphenyl). |
| Q: What is the CAS number of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: CAS number of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is 124946-65-2. |
| Q: What is the SMILES notation of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: SMILES notation of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is COc1ccc(C=CC(C)=O)c(O)c1. |
| Q: What is the molecular weight of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: Molecular weight of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is 192.21100. |
| Q: What is the polar surface area (PSA) of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: Polar surface area (PSA) of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is 46.53000. |
| Q: What is the English name of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: The English name of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one. |
| Q: What is the InChIKey of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: InChIKey of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is WBNXNIPUDZZFBV-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: LogP of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is 2.00300. |
| Q: What is the molecular formula of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one? |
| A: Molecular formula of 4-(2-hydroxy-4-methoxyphenyl)but-3-en-2-one is C11H12O3. |