8-Prenylluteone structure
|
Common Name | 8-Prenylluteone | ||
|---|---|---|---|---|
| CAS Number | 125002-91-7 | Molecular Weight | 422.47 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 668.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3±25.0 °C | |
Use of 8-Prenylluteone8-Prenylluteone is a HIV-1 protease inhibitor, with an IC50 of 4 μM[1]. |
| Name | 2-(4-Methoxyphenyl)-4-oxo-7-{[2,3,4-tri-O-acetyl-6-O-(2,3,4-tri-O -acetyl-6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy}-4H-ch romen-5-yl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Prenylluteone is a HIV-1 protease inhibitor, with an IC50 of 4 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 668.9±55.0 °C at 760 mmHg |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.47 |
| Flash Point | 229.3±25.0 °C |
| Exact Mass | 422.172943 |
| PSA | 111.13000 |
| LogP | 7.18 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | VYELCIXMHUBNAL-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2occ(-c3ccc(O)cc3O)c(=O)c2c1O |
| 3-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)- |