AKOS B015441 structure
|
Common Name | AKOS B015441 | ||
|---|---|---|---|---|
| CAS Number | 125096-55-1 | Molecular Weight | 208.25700 | |
| Density | 1.101g/cm3 | Boiling Point | 405.1ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.8ºC | |
| Name | 2-(2,4-dimethylphenoxy)propanehydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 405.1ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 198.8ºC |
| Exact Mass | 208.12100 |
| PSA | 64.35000 |
| LogP | 2.15180 |
| Vapour Pressure | 8.96E-07mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | KPSFMYYHYJMRAG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(C)C(=O)NN)c(C)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,6-dimethoxyphenylisocyanate |