7-Amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylic acid 1,1-dimethylethyl ester structure
|
Common Name | 7-Amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylic acid 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1250998-24-3 | Molecular Weight | 228.29 | |
| Density | 1.17±0.1 g/cm3(Predicted) | Boiling Point | 331.2±42.0 °C(Predicted) | |
| Molecular Formula | C11H20N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 7-Amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylic acid 1,1-dimethylethyl ester |
|---|
| Density | 1.17±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 331.2±42.0 °C(Predicted) |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 |
| Appearance of Characters | (Faint Yellow Solid) |
| InChIKey | DJQMEIQMZYMIIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(N)CO2)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |