Trichachnine structure
|
Common Name | Trichachnine | ||
|---|---|---|---|---|
| CAS Number | 1251-85-0 | Molecular Weight | 388.462 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 515.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H24N4O2 | Melting Point | 156 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 212.5±25.2 °C | |
| Name | Diantipyryl methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 515.2±60.0 °C at 760 mmHg |
| Melting Point | 156 °C (dec.)(lit.) |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.462 |
| Flash Point | 212.5±25.2 °C |
| Exact Mass | 388.189911 |
| PSA | 53.86000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | QATHNKNPUVVKHK-UHFFFAOYSA-N |
| SMILES | Cc1c(Cc2c(C)n(C)n(-c3ccccc3)c2=O)c(=O)n(-c2ccccc2)n1C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2942000000 |
|---|
| Diantipyrinylmethane |
| 4,4'-Methylenebis(1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one) |
| 4,4'-Methylenediantipyrine monohydrate |
| Trichachnine |
| EINECS 215-009-7 |
| 3H-Pyrazol-3-one, 4,4'-methylenebis[1,2-dihydro-1,5-dimethyl-2-phenyl- |
| 4,4'-Methylenebis(1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one) |
| Diantipyrylmethane |
| Bisantipyrylmethane |
| 4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)methyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| Di-(1-phenyl-2,3-dimethylpyrazolon-5-yl)methane |
| 4,4'-Diantipyrylmethane |
| MFCD00003147 |
| 4,4'-Diantipyrylmethane Monohydrate |
| 4,4'-Methylenebis(1,5-dimethyl-2-phenyl-1H-pyrazol-3(2H)-one) |