SPDP-dPEG structure
|
Common Name | SPDP-dPEG | ||
|---|---|---|---|---|
| CAS Number | 1252257-56-9 | Molecular Weight | 735.863 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H49N3O13S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPDP-dPEGLC-PEG8-SPDP is a cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
| Name | N-{27-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-27-oxo-3,6,9,12,15,18,21,24-octaoxaheptacos-1-yl}-3-(2-pyridinyldisulfanyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Description | LC-PEG8-SPDP is a cleavable ADC linker used for the antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C31H49N3O13S2 |
| Molecular Weight | 735.863 |
| Exact Mass | 735.270691 |
| LogP | -2.32 |
| Index of Refraction | 1.555 |
| InChIKey | HKFFRXQWQMCBEO-UHFFFAOYSA-N |
| SMILES | O=C(CCSSc1ccccn1)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| N-{27-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-27-oxo-3,6,9,12,15,18,21,24-octaoxaheptacos-1-yl}-3-(2-pyridinyldisulfanyl)propanamide |