CHEMBRDG-BB 9071646 structure
|
Common Name | CHEMBRDG-BB 9071646 | ||
|---|---|---|---|---|
| CAS Number | 125418-89-5 | Molecular Weight | 247.29000 | |
| Density | 1.184g/cm3 | Boiling Point | 455.1ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229ºC | |
| Name | 2-(2-oxo-2-piperidin-1-ylethoxy)benzaldehyde |
|---|
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 455.1ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 229ºC |
| Exact Mass | 247.12100 |
| PSA | 46.61000 |
| LogP | 1.82830 |
| Vapour Pressure | 1.81E-08mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | KHYZSSDWPPTXEK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccccc1OCC(=O)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |