sulfanium,chlorobenzene,1-chloro-4-(4-chlorophenyl)benzene,bromide structure
|
Common Name | sulfanium,chlorobenzene,1-chloro-4-(4-chlorophenyl)benzene,bromide | ||
|---|---|---|---|---|
| CAS Number | 125428-43-5 | Molecular Weight | 446.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12BrCl3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sulfanium,chlorobenzene,1-chloro-4-(4-chlorophenyl)benzene,bromide |
|---|
| Molecular Formula | C18H12BrCl3S |
|---|---|
| Molecular Weight | 446.61600 |
| Exact Mass | 443.89100 |
| PSA | 25.30000 |
| LogP | 3.74620 |
| InChIKey | PHTBQOMINPCBKS-UHFFFAOYSA-M |
| SMILES | Clc1ccc([S+](c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1.[Br-] |
|
~%
sulfanium,chlor... CAS#:125428-43-5 |
| Literature: Dektar, John L.; Hacker, Nigel P. Journal of the American Chemical Society, 1990 , vol. 112, # 16 p. 6004 - 6015 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |