Bis(4-chlorophenyl) sulfoxide structure
|
Common Name | Bis(4-chlorophenyl) sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 3085-42-5 | Molecular Weight | 271.162 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 406.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Cl2OS | Melting Point | 141-144 °C(lit.) | |
| MSDS | N/A | Flash Point | 199.5±24.6 °C | |
| Name | 1-chloro-4-(4-chlorophenyl)sulfinylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.2±30.0 °C at 760 mmHg |
| Melting Point | 141-144 °C(lit.) |
| Molecular Formula | C12H8Cl2OS |
| Molecular Weight | 271.162 |
| Flash Point | 199.5±24.6 °C |
| Exact Mass | 269.967285 |
| PSA | 36.28000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.690 |
| InChIKey | KJGYFISADIZFEL-UHFFFAOYSA-N |
| SMILES | O=S(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Safety Phrases | S24/25 |
|---|---|
| WGK Germany | 3 |
| RTECS | WS2275000 |
| HS Code | 2930909090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 4,4'-Dichloro Diphenyl Sulfoxide |
| MFCD00000618 |
| 4-Chlorophenyl Sulfoxide |
| p-Chlorophenyl sulfoxide |
| Bis(4-chlorophenyl) sulfoxide |
| 4,4'-dichlorodiphenyl sulphoxide |
| 4,4'-dichlorodiphenyl sulfoxide |
| 1,1'-Sulfinylbis(4-chlorobenzene) |
| Bis(4-chlorophenyl)sulfoniumolate |
| EINECS 221-397-9 |
| sulfonium, bis(4-chlorophenyl)hydroxy-, inner salt |
| 4,4'-dichlorodiphenyl sulfone |
| Di-p-chlorophenyl sulfoxide |