Atrazine-3-mercaptopropanoic acid structure
|
Common Name | Atrazine-3-mercaptopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 125454-31-1 | Molecular Weight | 285.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Atrazine-3-mercaptopropanoic acidAtrazine-3-mercaptopropanoic acid is a hapten. The IC50 value of polyclonal antibody (PcAb) 1 with coating Atrazine-3-mercaptopropanoic acid is 7.5 ng/mL[1]. |
| Name | 3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Atrazine-3-mercaptopropanoic acid is a hapten. The IC50 value of polyclonal antibody (PcAb) 1 with coating Atrazine-3-mercaptopropanoic acid is 7.5 ng/mL[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H19N5O2S |
|---|---|
| Molecular Weight | 285.36600 |
| Exact Mass | 285.12600 |
| PSA | 131.79000 |
| LogP | 0.53430 |
| InChIKey | BQNJSWJSQJAQCA-UHFFFAOYSA-N |
| SMILES | CCNc1nc(NC(C)C)nc(SCCC(=O)O)n1 |
| 3-{[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl}propanoic acid |