Methyl 2,4-difluoro-5-nitrobenzoate structure
|
Common Name | Methyl 2,4-difluoro-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 125568-71-0 | Molecular Weight | 217.126 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 310.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.3±27.9 °C | |
| Name | Methyl 2,4-difluoro-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.1±42.0 °C at 760 mmHg |
| Molecular Formula | C8H5F2NO4 |
| Molecular Weight | 217.126 |
| Flash Point | 141.3±27.9 °C |
| Exact Mass | 217.018661 |
| PSA | 72.12000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | KLMBOVOUTOBMLS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(F)cc1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~99%
Methyl 2,4-difl... CAS#:125568-71-0 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO KG Patent: WO2007/19674 A1, 2007 ; Location in patent: Page/Page column 45 ; |
|
~88%
Methyl 2,4-difl... CAS#:125568-71-0 |
| Literature: Shionogi and Co., Ltd. Patent: WO2005/121132 A1, 2005 ; Location in patent: Page/Page column 227-228 ; |
|
~%
Methyl 2,4-difl... CAS#:125568-71-0 |
| Literature: US2004/220235 A1, ; |
|
~%
Methyl 2,4-difl... CAS#:125568-71-0 |
| Literature: Journal of Organic Chemistry, , vol. 55, # 7 p. 2034 - 2044 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl 2,4-difluoro-5-nitrobenzoate |
| Benzoic acid, 2,4-difluoro-5-nitro-, methyl ester |
| 2,4-Difluoro-5-Nitrobenzoic Acid Methyl Ester |