Ethyl (4-isopropoxy-3-methoxyphenyl)acetate structure
|
Common Name | Ethyl (4-isopropoxy-3-methoxyphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 1256581-66-4 | Molecular Weight | 252.306 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 328.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.9±23.8 °C | |
| Name | Ethyl 2-(4-isopropoxy-3-methoxyphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.8±27.0 °C at 760 mmHg |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.306 |
| Flash Point | 140.9±23.8 °C |
| Exact Mass | 252.136154 |
| PSA | 44.76000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | GIUFMFBEWZVERI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(OC(C)C)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~89%
Ethyl (4-isopro... CAS#:1256581-66-4 |
| Literature: US2012/129871 A1, ; Page/Page column 13-14 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 2-(3-methoxy-4-propan-2-yloxyphenyl)acetate |
| Benzeneacetic acid, 3-methoxy-4-(1-methylethoxy)-, ethyl ester |
| Ethyl (4-isopropoxy-3-methoxyphenyl)acetate |