11H,13H-Oxireno[d]pyrano[4',3':3,3a]isobenzofuro[5,4-f][2]benzopyran-6,13(5aH)-dione,8-(3-furanyl)dodecahydro-4-hydroxy-2,2,4a,8a-tetramethyl-,(2aR,4S,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)- (9CI) structure
|
Common Name | 11H,13H-Oxireno[d]pyrano[4',3':3,3a]isobenzofuro[5,4-f][2]benzopyran-6,13(5aH)-dione,8-(3-furanyl)dodecahydro-4-hydroxy-2,2,4a,8a-tetramethyl-,(2aR,4S,4aS,4bR,5aS,8S,8aS,10aR,10bR,14aS)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1258-86-2 | Molecular Weight | 472.52700 | |
| Density | 1.39g/cm3 | Boiling Point | 675.8ºC at 760 mmHg | |
| Molecular Formula | C26H32O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.5ºC | |
| Name | Epilimonol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 675.8ºC at 760 mmHg |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.52700 |
| Flash Point | 362.5ºC |
| Exact Mass | 472.21000 |
| PSA | 107.73000 |
| LogP | 2.92920 |
| Vapour Pressure | 3.47E-19mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | ZFIURKZEANVFML-UHFFFAOYSA-N |
| SMILES | CC1(C)OC2CC(=O)OCC23C1CC(O)C1(C)C3CCC2(C)C(c3ccoc3)OC(=O)C3OC321 |
|
~%
11H,13H-Oxireno... CAS#:1258-86-2 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 50, # 23 p. 6766 - 6774 |
|
~%
11H,13H-Oxireno... CAS#:1258-86-2 |
| Literature: Helvetica Chimica Acta, , vol. 40, p. 1420,1433 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| epi-limonol |
| Epiborneol |
| 4,7,7-trimethyl-2-bicyclo[2.2.1]heptanol |
| 3-Bornanol |
| Epiisoborneol |
| Epiborneol (endo-3-Hydroxy-1,7,7-trimethyl-bicyclo<2.2.1>heptan) |