Limonol structure
|
Common Name | Limonol | ||
|---|---|---|---|---|
| CAS Number | 989-61-7 | Molecular Weight | 472.53 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 675.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H32O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.5±31.5 °C | |
Use of LimonolLimonol can be isolated from the seeds of Citrus paradisi[1]. |
| Name | Limonol |
|---|---|
| Synonym | More Synonyms |
| Description | Limonol can be isolated from the seeds of Citrus paradisi[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 675.8±55.0 °C at 760 mmHg |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 |
| Flash Point | 362.5±31.5 °C |
| Exact Mass | 472.209717 |
| PSA | 107.73000 |
| LogP | 0.82 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | ZFIURKZEANVFML-GBBYEGBZSA-N |
| SMILES | CC1(C)OC2CC(=O)OCC23C1CC(O)C1(C)C3CCC2(C)C(c3ccoc3)OC(=O)C3OC321 |
| Hazard Codes | Xi |
|---|
| (4aS,6aR,8R,8aS,12S,12aS,14aR,14bR)-12-(3-Furyl)-8-hydroxy-6,6,8a,12a-tetramethyldodecahydro-3H-oxireno[d]pyrano[4',3':3,3a][2]benzofuro[5,4-f]isochromene-3,10(9aH)-dione |
| (4aS,6aR,8R,8aS,8bR,9aS,12S,12aS,14aR,14bR)-12-(3-Furyl)-8-hydroxy-6,6,8a,12a-tetramethyldodecahydro-3H-oxireno[d]pyrano[4',3':3,3a][2]benzofuro[5,4-f]isochromene-3,10(9aH)-dione |
| 1H,3H-Oxireno[c]pyrano[4'',3'':2',3']furo[3',4':5,6]naphtho[1,2-d]pyran-3,10(9aH)-dione, 12-(3-furanyl)dodecahydro-8-hydroxy-6,6,8a,12a-tetramethyl-, (4aS,6aR,8R,8aS,12S,12aS,14aR,14bR)- |
| 1H,3H-Oxireno[c]pyrano[4'',3'':2',3']furo[3',4':5,6]naphtho[1,2-d]pyran-3,10(9aH)-dione, 12-(3-furanyl)dodecahydro-8-hydroxy-6,6,8a,12a-tetramethyl-, (4aS,6aR,8R,8aS,8bR,9aS,12S,12aS,14aR,14bR)- |