4-[(9-benzyl-2-chloropurin-6-yl)amino]benzonitrile structure
|
Common Name | 4-[(9-benzyl-2-chloropurin-6-yl)amino]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 125802-53-1 | Molecular Weight | 360.80000 | |
| Density | 1.38g/cm3 | Boiling Point | 563.1ºC at 760 mmHg | |
| Molecular Formula | C19H13ClN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.3ºC | |
| Name | 4-[(9-benzyl-2-chloropurin-6-yl)amino]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 563.1ºC at 760 mmHg |
| Molecular Formula | C19H13ClN6 |
| Molecular Weight | 360.80000 |
| Flash Point | 294.3ºC |
| Exact Mass | 360.08900 |
| PSA | 79.42000 |
| LogP | 4.21628 |
| Vapour Pressure | 1.05E-12mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | NVQXKMMKLNDXDK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Nc2nc(Cl)nc3c2ncn3Cc2ccccc2)cc1 |
|
~44%
4-[(9-benzyl-2-... CAS#:125802-53-1 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzonitrile,4-[[2-chloro-9-(phenylmethyl)-9H-purin-6-yl]amino] |