9-benzyl-N-(3-butoxyphenyl)-2-chloropurin-6-amine structure
|
Common Name | 9-benzyl-N-(3-butoxyphenyl)-2-chloropurin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 125802-57-5 | Molecular Weight | 407.89600 | |
| Density | 1.28g/cm3 | Boiling Point | 557.8ºC at 760mmHg | |
| Molecular Formula | C22H22ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 9-benzyl-N-(3-butoxyphenyl)-2-chloropurin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 557.8ºC at 760mmHg |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.89600 |
| Flash Point | 291.1ºC |
| Exact Mass | 407.15100 |
| PSA | 64.86000 |
| LogP | 5.52350 |
| Vapour Pressure | 1.78E-12mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | WLTFBUVJMBYUCR-UHFFFAOYSA-N |
| SMILES | CCCCOc1cccc(Nc2nc(Cl)nc3c2ncn3Cc2ccccc2)c1 |
|
~%
9-benzyl-N-(3-b... CAS#:125802-57-5 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
|
~%
9-benzyl-N-(3-b... CAS#:125802-57-5 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
|
~69%
9-benzyl-N-(3-b... CAS#:125802-57-5 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
| 9-benzyl-6-(3-butoxyanilino)-2-chloro-9H-purine |
| 9H-Purin-6-amine,N-(3-butoxyphenyl)-2-chloro-9-(phenylmethyl) |