bis-(4-dimethylamino-phenyl)-phenyl-d5-carbenium picrate structure
|
Common Name | bis-(4-dimethylamino-phenyl)-phenyl-d5-carbenium picrate | ||
|---|---|---|---|---|
| CAS Number | 1258668-21-1 | Molecular Weight | 562.58500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H22D5N5O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS02, GHS06 |
Signal Word | Danger | |
Use of bis-(4-dimethylamino-phenyl)-phenyl-d5-carbenium picrateMalachite green-d5 (picrate) is the deuterium labeled Malachite green picrate[1]. |
| Name | [4-[[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium,2,4,6-trinitrophenolate |
|---|---|
| Synonym | More Synonyms |
| Description | Malachite green-d5 (picrate) is the deuterium labeled Malachite green picrate[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C29H22D5N5O7 |
|---|---|
| Molecular Weight | 562.58500 |
| Exact Mass | 562.22200 |
| PSA | 166.77000 |
| LogP | 7.51820 |
| InChIKey | HKJSJDRORUIJJI-AYVDECCJSA-M |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| Storage condition | -20°C |
| Symbol |
GHS02, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228-H301 |
| Precautionary Statements | P210-P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P2 (EN 143) respirator cartridges;type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,T |
| Risk Phrases | 11-25 |
| Safety Phrases | 45 |
| RIDADR | UN 2926 4.1/PG 3 |
| Malachite Green-d5 picrate |
| Bis-(4-dimethylaminophenyl)-phenyl-d5-carbenium picrate |