1-(1-phenylethyl)indole-2,3-dione structure
|
Common Name | 1-(1-phenylethyl)indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 125941-72-2 | Molecular Weight | 251.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1-phenylethyl)indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO2 |
|---|---|
| Molecular Weight | 251.28000 |
| Exact Mass | 251.09500 |
| PSA | 37.38000 |
| LogP | 3.04210 |
| InChIKey | UBEPPALAFUEXBM-UHFFFAOYSA-N |
| SMILES | CC(c1ccccc1)N1C(=O)C(=O)c2ccccc21 |
|
~82%
1-(1-phenylethy... CAS#:125941-72-2 |
| Literature: Hung, Chi-Ying; Hsu, Mei-Hua; Huang, Li-Jiau; Hwang, Chrong-Shiong; Lee, On; Wu, Chen-Yi; Chen, Chih-Hung; Kuo, Sheng-Chu Bioorganic and Medicinal Chemistry, 2008 , vol. 16, # 8 p. 4222 - 4232 |
|
~46%
1-(1-phenylethy... CAS#:125941-72-2 |
| Literature: Katritzky, Alan R.; Fan, Wei-Qiang; Liang, De-Sheng; Li, Qiao-Ling Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 1541 - 1546 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Indole-2,3-dione,1-(1-phenylethyl) |
| 1-(1-phenylethyl)-1H-indole-2,3-dione |
| 1-(1-phenylethyl)isatin |