1-(1-piperidylmethyl)indole-2,3-dione structure
|
Common Name | 1-(1-piperidylmethyl)indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 13129-69-6 | Molecular Weight | 244.28900 | |
| Density | 1.261g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 1-(piperidin-1-ylmethyl)indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Flash Point | 175.4ºC |
| Exact Mass | 244.12100 |
| PSA | 40.62000 |
| LogP | 1.66220 |
| Vapour Pressure | 2.38E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | SUNRAOPHWRLAPV-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)N(CN2CCCCC2)c2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isatin-based compound,60 |
| N-piperidinomethylisatin |
| 1-Piperidinomethyl-indolin-2,3-dion |
| 1-piperidin-1-ylmethyl-indole-2,3-dione |
| 1-piperidinomethyl isatin |